2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate structure
|
Common Name | 2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 34006-76-3 | Molecular Weight | 236.26400 | |
| Density | 1.1g/cm3 | Boiling Point | 307.8ºC at 760mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | 2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 307.8ºC at 760mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 160.9ºC |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 2.43010 |
| Index of Refraction | 1.505 |
| InChIKey | XXFSYINDUHLBIL-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OC |
| HS Code | 2917349000 |
|---|
|
~%
2-O-butyl 1-O-m... CAS#:34006-76-3 |
| Literature: Suzuki; Yaguchi; Suga Environmental Science and Technology, 2001 , vol. 35, # 18 p. 3757 - 3763 |
|
~%
2-O-butyl 1-O-m... CAS#:34006-76-3 |
| Literature: Suzuki; Yaguchi; Suga Environmental Science and Technology, 2001 , vol. 35, # 18 p. 3757 - 3763 |
|
~%
2-O-butyl 1-O-m... CAS#:34006-76-3 |
| Literature: Nagel; Abelsdorff Wiss. Veroeff. Siemens, vol. 5, p. 205 Chem. Zentralbl., 1927 , vol. 98, # I p. 78 |
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,2-Benzenedicarboxylic acid,butyl methyl ester |
| Phthalsaeure-butylester-methylester |
| phthalic acid butyl ester-methyl ester |
| Methyl-butyl-phthalat |
| Methyl butyl phthalate |
| Phthalic acid,butyl methyl ester |
| Methyl-n-butylphthalat |
| BUTYL METHYL PHTHALATE |