trichloro-(1-phenyl-2-trichlorosilylethyl)silane structure
|
Common Name | trichloro-(1-phenyl-2-trichlorosilylethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 3401-10-3 | Molecular Weight | 373.03800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trichloro-(1-phenyl-2-trichlorosilylethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Cl6Si2 |
|---|---|
| Molecular Weight | 373.03800 |
| Exact Mass | 369.83000 |
| LogP | 5.71550 |
| InChIKey | JHWRKSTZGOERCZ-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CC(c1ccccc1)[Si](Cl)(Cl)Cl |
| HS Code | 2931900090 |
|---|
|
~72%
trichloro-(1-ph... CAS#:3401-10-3 |
| Literature: KOREA INSTITUTE OF SCIENCE AND TECHNOLOGY Patent: US2004/82803 A1, 2004 ; Location in patent: Page 3 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1.2-Bis-trichlorsilyl-2-phenyl-ethan |