3-bromo-2-methylamino-fluoren-9-one structure
|
Common Name | 3-bromo-2-methylamino-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 3404-88-4 | Molecular Weight | 288.13900 | |
| Density | 1.596g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C14H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | 3-bromo-2-(methylamino)fluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C14H10BrNO |
| Molecular Weight | 288.13900 |
| Flash Point | 235.9ºC |
| Exact Mass | 286.99500 |
| PSA | 29.10000 |
| LogP | 3.77520 |
| Index of Refraction | 1.719 |
| InChIKey | CZIGPUSHPQBNLR-UHFFFAOYSA-N |
| SMILES | CNc1cc2c(cc1Br)-c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Methylamino-9-oxo-3-brom-fluoren |