2-(benzylideneamino)-3-bromo-fluoren-9-one
Modify Date: 2025-08-30 11:52:53
2-(benzylideneamino)-3-bromo-fluoren-9-one structure
|
Common Name | 2-(benzylideneamino)-3-bromo-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 3405-13-8 | Molecular Weight | 362.21900 | |
| Density | 1.42g/cm3 | Boiling Point | 560.5ºC at 760 mmHg | |
| Molecular Formula | C20H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.8ºC | |
| Name | 2-(benzylideneamino)-3-bromofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 560.5ºC at 760 mmHg |
| Molecular Formula | C20H12BrNO |
| Molecular Weight | 362.21900 |
| Flash Point | 292.8ºC |
| Exact Mass | 361.01000 |
| PSA | 29.43000 |
| LogP | 5.41110 |
| Index of Refraction | 1.676 |
| InChIKey | JENQTJINIMTWFE-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-c2cc(Br)c(N=Cc3ccccc3)cc21 |
| HS Code | 2922399090 |
|---|
|
~%
2-(benzylidenea... CAS#:3405-13-8 |
| Literature: Fletcher,T.L.; Pan,H.-L. Journal of the Chemical Society, 1965 , p. 4588 - 4591 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Benzylamino-3-brom-fluorenon |