N-methyl-2-(N-methylanilino)-N-phenylacetamide structure
|
Common Name | N-methyl-2-(N-methylanilino)-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 34066-47-2 | Molecular Weight | 254.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-2-(N-methylanilino)-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18N2O |
|---|---|
| Molecular Weight | 254.32700 |
| Exact Mass | 254.14200 |
| PSA | 23.55000 |
| LogP | 2.78580 |
| InChIKey | BQNPOMRSZCIYMO-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)N(C)c1ccccc1)c1ccccc1 |
|
~%
N-methyl-2-(N-m... CAS#:34066-47-2 |
| Literature: Ferruti,P. et al. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 2984 - 2985 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-Dimethyl-N,N'-diphenylaminoacetamid |