Acetonitrile, [ethylenebis(oxy-p-phenylene)]di
Modify Date: 2025-09-09 16:34:51
![Acetonitrile, [ethylenebis(oxy-p-phenylene)]di Structure](https://www.chemsrc.com/extcaspic/304/34074-31-2.png)
Acetonitrile, [ethylenebis(oxy-p-phenylene)]di structure
|
Common Name | Acetonitrile, [ethylenebis(oxy-p-phenylene)]di | ||
|---|---|---|---|---|
| CAS Number | 34074-31-2 | Molecular Weight | 292.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetonitrile, [ethylenebis(oxy-p-phenylene)]di |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16N2O2 |
|---|---|
| Molecular Weight | 292.3 |
| InChIKey | ZAJTVMOTCINOGD-UHFFFAOYSA-N |
| SMILES | N#CCc1ccc(OCCOc2ccc(CC#N)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 34074-31-2? |
| A: Chinese name of 34074-31-2 is 34074-31-2. |
| Q: What is the SMILES notation of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: SMILES notation of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is N#CCc1ccc(OCCOc2ccc(CC#N)cc2)cc1. |
| Q: What is the molecular weight of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: Molecular weight of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is 292.3. |
| Q: What is the InChIKey of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: InChIKey of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is ZAJTVMOTCINOGD-UHFFFAOYSA-N. |
| Q: What is the English name of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: The English name of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is Acetonitrile, [ethylenebis(oxy-p-phenylene)]di. |
| Q: What is the CAS number of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: CAS number of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is 34074-31-2. |
| Q: What is the molecular formula of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di? |
| A: Molecular formula of Acetonitrile, [ethylenebis(oxy-p-phenylene)]di is C18H16N2O2. |