7-O-Methylbiochanin A structure
|
Common Name | 7-O-Methylbiochanin A | ||
|---|---|---|---|---|
| CAS Number | 34086-51-6 | Molecular Weight | 298.29000 | |
| Density | 1.321 g/cm3 | Boiling Point | 515.2ºC at 760 mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7-O-Methylbiochanin A7-O-Methylbiochanin A (4',7-Dimethoxy-5-hydroxyisoflavone) is an isoflavone derivative isolated from the roots of Lotus polyphyllos[1]. |
| Name | 5-hydroxy-7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-O-Methylbiochanin A (4',7-Dimethoxy-5-hydroxyisoflavone) is an isoflavone derivative isolated from the roots of Lotus polyphyllos[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.321 g/cm3 |
|---|---|
| Boiling Point | 515.2ºC at 760 mmHg |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |
| Index of Refraction | 1.621 |
| InChIKey | DQNLRFRBAWCJHQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2coc3cc(OC)cc(O)c3c2=O)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| dimethylgenistein |
| 4',7-dimethoxy-5-hydroxy-isoflavone |
| 4',7-dimethoxy-7-hydroxyisoflavone |
| Genistein-4',7-dimethylether |
| 7,4'-dimethoxy-5-hydroxyisoflavone |
| 5-hydroxy-4',7-dimethoxyisoflavone |
| MFCD00075976 |
| 4H-1-Benzopyran-4-one,5-hydroxy-7-methoxy-3-(4-methoxyphenyl) |