ethyl 6,8-dihydro-7h-[1,3]dioxolo[4,5-g]pyrrolo[3,4-b]quinoline-7-carboxylate structure
|
Common Name | ethyl 6,8-dihydro-7h-[1,3]dioxolo[4,5-g]pyrrolo[3,4-b]quinoline-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 34086-69-6 | Molecular Weight | 286.28300 | |
| Density | 1.415g/cm3 | Boiling Point | 470.2ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.2ºC | |
| Name | ethyl 6,8-dihydro-7h-[1,3]dioxolo[4,5-g]pyrrolo[3,4-b]quinoline-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 470.2ºC at 760 mmHg |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.28300 |
| Flash Point | 238.2ºC |
| Exact Mass | 286.09500 |
| PSA | 60.89000 |
| LogP | 2.37350 |
| Index of Refraction | 1.664 |
| InChIKey | WZLMSSOUPUEQIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1Cc2cc3cc4c(cc3nc2C1)OCO4 |
|
~%
ethyl 6,8-dihyd... CAS#:34086-69-6 |
| Literature: Zalkow,L.N. et al. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 3551 - 3554 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,8-dihydro-[1,3]dioxolo[4,5-g]pyrrolo[3,4-b]quinoline-7-carboxylic acid ethyl ester |
| 6,7-Methylendioxypyrrolochinolin (19) |