3-Nitro-5-methylimidazo[1,2-a]pyridine structure
|
Common Name | 3-Nitro-5-methylimidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 34165-08-7 | Molecular Weight | 177.16000 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-3-nitroimidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16000 |
| Exact Mass | 177.05400 |
| PSA | 63.12000 |
| LogP | 2.07410 |
| Index of Refraction | 1.676 |
| InChIKey | OGZKKWYLIWRTHQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc2ncc([N+](=O)[O-])n12 |
| HS Code | 2933990090 |
|---|
|
~62%
3-Nitro-5-methy... CAS#:34165-08-7 |
| Literature: Ikemoto, Tomomi; Wakimasu, Mitsuhiro Heterocycles, 2001 , vol. 55, # 1 p. 99 - 108 |
|
~%
3-Nitro-5-methy... CAS#:34165-08-7 |
| Literature: Ikemoto, Tomomi; Wakimasu, Mitsuhiro Heterocycles, 2001 , vol. 55, # 1 p. 99 - 108 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methyl-3-nitro-imidazo[1,2-a]pyridine |
| 3-nitro-5-methylimidazo[1,2-a]pyridine |