Chartarin structure
|
Common Name | Chartarin | ||
|---|---|---|---|---|
| CAS Number | 34170-23-5 | Molecular Weight | 334.27900 | |
| Density | 1.673g/cm3 | Boiling Point | 700.7ºC at 760mmHg | |
| Molecular Formula | C19H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265ºC | |
| Name | Chartarin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.673g/cm3 |
|---|---|
| Boiling Point | 700.7ºC at 760mmHg |
| Molecular Formula | C19H10O6 |
| Molecular Weight | 334.27900 |
| Flash Point | 265ºC |
| Exact Mass | 334.04800 |
| PSA | 100.88000 |
| LogP | 3.36320 |
| Index of Refraction | 1.816 |
| InChIKey | DMUDOHBALWPMIZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2oc(=O)c3c(O)c4cccc(=O)c4c4oc(O)c1c2c34 |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| chartreusin aglycone |
| Chartreusin-Aglykon |