(2-aminophenyl)-[2,5-bis(trifluoromethyl)phenyl]methanone structure
|
Common Name | (2-aminophenyl)-[2,5-bis(trifluoromethyl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 34186-96-4 | Molecular Weight | 333.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-aminophenyl)-[2,5-bis(trifluoromethyl)phenyl]methanone |
|---|
| Molecular Formula | C15H9F6NO |
|---|---|
| Molecular Weight | 333.22800 |
| Exact Mass | 333.05900 |
| PSA | 43.09000 |
| LogP | 5.11860 |
| InChIKey | IJMYKMHAVVYXOU-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |