Phosphorodithioic acid,O,O-bis(1-methylethyl) ester, potassium salt (1:1)
Modify Date: 2025-08-20 10:29:16
Phosphorodithioic acid,O,O-bis(1-methylethyl) ester, potassium salt (1:1) structure
|
Common Name | Phosphorodithioic acid,O,O-bis(1-methylethyl) ester, potassium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3419-34-9 | Molecular Weight | 252.37600 | |
| Density | 1.145g/cm3 | Boiling Point | 257.1ºC at 760mmHg | |
| Molecular Formula | C6H14KO2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.3ºC | |
| Name | potassium di-iso-propyldithiophosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 257.1ºC at 760mmHg |
| Molecular Formula | C6H14KO2PS2 |
| Molecular Weight | 252.37600 |
| Flash Point | 109.3ºC |
| Exact Mass | 251.98100 |
| PSA | 100.54000 |
| LogP | 3.80820 |
| InChIKey | PJJZTOTXLDXTEL-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=S)(S)OC(C)C.[K+] |
| HS Code | 2931900090 |
|---|
|
~%
Phosphorodithio... CAS#:3419-34-9 |
| Literature: Bond, Alan M.; Colton, Ray; Dakternieks, Dainis; Dillon, Michael L.; Hauenstein, Jennifer; Moir, John E. Australian Journal of Chemistry, 1981 , vol. 34, # 7 p. 1393 - 1400 |
CAS#:22615-19-6
CAS#:28519-19-9
CAS#:69923-44-0
CAS#:37744-85-7| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphorodithioic acid,O,O-bis(2-methylpropyl)ester,potassium salt (9CI) |
| potassium diisopropyldithiophosphate |
| potassium O,O-diisopropyldithiophosphate |
| potassium O,O'-di-isopropyldithiophospate |
| CTK4H4660 |
| dithiophosphoric acid O,O'-diisobutyl ester,potassium salt |
| (O,O'-diisobutyl)dithiophosphato potassium |
| Isobutylpotassium phosphorodithioate (6CI,7CI) |
| potassium O,O'-di-iso-propyl phosphorodithioate |
| Phosphorodithioic acid,O,O-bis(2-methylpropyl) ester,potassium salt (1:1) |
| potassium O,O'-di-isobutyldithiophosphate |
| potassium di-iso-butyldithiophosphate |