L-Isoleucine,N-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | L-Isoleucine,N-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 34235-81-9 | Molecular Weight | 285.35900 | |
| Density | 1.218g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C13H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | 3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.35900 |
| Flash Point | 226ºC |
| Exact Mass | 285.10300 |
| PSA | 91.85000 |
| LogP | 3.24430 |
| Index of Refraction | 1.537 |
| InChIKey | VPXRIBOJICTEAH-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)O |
|
~59%
L-Isoleucine,N-... CAS#:34235-81-9 |
| Literature: Sdira, Sofiane Ben; Felix, Caroline P.; Giudicelli, Marie-Beatrice A.; Seigle-Ferrand, Pascal F.; Perrin, Monique; Lamartine, Roger J. Journal of Organic Chemistry, 2003 , vol. 68, # 17 p. 6632 - 6638 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-(p-toluenesulfonyl)-L-isoleucine |
| 4-toluenesulfonyl-L-isoleucine |
| N-(toluene-4-sulfonyl)-L-isoleucine |
| N-(p-toluenesulfonyl)-isoleucine |
| N-tosyl-(S)-isoleucine |