1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid structure
|
Common Name | 1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 342386-78-1 | Molecular Weight | 231.075 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 376.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4±27.9 °C | |
| Name | 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.4±42.0 °C at 760 mmHg |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.075 |
| Flash Point | 181.4±27.9 °C |
| Exact Mass | 229.990128 |
| PSA | 37.30000 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | VNBCEUVYNYCYBW-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Cl)c(Cl)c2)CC1 |
|
~71%
1-(3,4-Dichloro... CAS#:342386-78-1 |
| Literature: Akopyan; Martirosyan; Mndzhoyan; Ter-Zakharyan; Kazaryan; Aleksanyan Pharmaceutical Chemistry Journal, 2001 , vol. 35, # 8 p. 421 - 423 |
|
~%
1-(3,4-Dichloro... CAS#:342386-78-1 |
| Literature: Cheng, CY; Lu, HY; Lee, FM European Journal of Medicinal Chemistry, 1991 , vol. 26, # 2 p. 125 - 128 |
|
~%
1-(3,4-Dichloro... CAS#:342386-78-1 |
| Literature: Cheng, CY; Lu, HY; Lee, FM European Journal of Medicinal Chemistry, 1991 , vol. 26, # 2 p. 125 - 128 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(3,4-dichlorophenyl)cyclopropane carboxylic acid |
| 1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid |
| Cyclopropanecarboxylic acid, 1-(3,4-dichlorophenyl)- |