2-Dichloromethylene-1,2,3,3,5,5-hexachlorocyclopent-1-ene structure
|
Common Name | 2-Dichloromethylene-1,2,3,3,5,5-hexachlorocyclopent-1-ene | ||
|---|---|---|---|---|
| CAS Number | 3424-05-3 | Molecular Weight | 355.68800 | |
| Density | 1.88g/cm3 | Boiling Point | 344.8ºC at 760mmHg | |
| Molecular Formula | C6Cl8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | 1,2,3,3,5,5-hexachloro-4-(dichloromethylidene)cyclopentene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 344.8ºC at 760mmHg |
| Molecular Formula | C6Cl8 |
| Molecular Weight | 355.68800 |
| Flash Point | 164ºC |
| Exact Mass | 351.75100 |
| LogP | 5.72620 |
| Index of Refraction | 1.608 |
| InChIKey | HSNOZNMQZFGXDR-UHFFFAOYSA-N |
| SMILES | ClC(Cl)=C1C(Cl)(Cl)C(Cl)=C(Cl)C1(Cl)Cl |
| HS Code | 2903890090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Hexachlor-4-dichlormethylen-cyclopenten |
| 1,2,3,3,5,5-Hexachlor-4-dichlormethylen-cyclopenten |
| octachloro-1-methyliden-cyclopent-3-ene |
| Perchloro-4-methylenecyclopentene |
| Perchloromethylene-3-cyclopentene |
| 4-Dichlormethylen-1,2,3,3,5,5-hexachlorcyclopenten |
| hexachloro-4-dichloromethylene-cyclopentene |
| 4-dichloromethylene-1,2,3,3,5,5-hexachlorocyclo-1-pentene |