[1-(4-Chlorophenyl)cyclohexyl]methanamine
Modify Date: 2026-09-26 12:55:35
![[1-(4-Chlorophenyl)cyclohexyl]methanamine Structure](https://www.chemsrc.com/extcaspic/055/342425-45-0.png)
[1-(4-Chlorophenyl)cyclohexyl]methanamine structure
|
Common Name | [1-(4-Chlorophenyl)cyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 342425-45-0 | Molecular Weight | 223.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(4-Chlorophenyl)cyclohexyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18ClN |
|---|---|
| Molecular Weight | 223.74 |
| InChIKey | NVXHEFNSQQTTPF-UHFFFAOYSA-N |
| SMILES | NCC1(c2ccc(Cl)cc2)CCCCC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Functional Uptake Assay (hNET) from US Patent US10562878: "Cycloalkylamines as monoam...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_2
|
|
Name: Functional Uptake Assay (hSERT) from US Patent US10562878: "Cycloalkylamines as monoa...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_1
|
|
Name: Functional Uptake Assay (hDAT) from US Patent US10562878: "Cycloalkylamines as monoa...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_3
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: CAS number of [1-(4-Chlorophenyl)cyclohexyl]methanamine is 342425-45-0. |
| Q: What is the InChIKey of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: InChIKey of [1-(4-Chlorophenyl)cyclohexyl]methanamine is NVXHEFNSQQTTPF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: Molecular weight of [1-(4-Chlorophenyl)cyclohexyl]methanamine is 223.74. |
| Q: What is the SMILES notation of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: SMILES notation of [1-(4-Chlorophenyl)cyclohexyl]methanamine is NCC1(c2ccc(Cl)cc2)CCCCC1. |
| Q: What is the molecular formula of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: Molecular formula of [1-(4-Chlorophenyl)cyclohexyl]methanamine is C13H18ClN. |
| Q: What is the Chinese name of 342425-45-0? |
| A: Chinese name of 342425-45-0 is 342425-45-0. |
| Q: What is the English name of [1-(4-Chlorophenyl)cyclohexyl]methanamine? |
| A: The English name of [1-(4-Chlorophenyl)cyclohexyl]methanamine is [1-(4-Chlorophenyl)cyclohexyl]methanamine. |