N-(2-Aminoethyl)-N-(pentachlorophenyl)amine structure
|
Common Name | N-(2-Aminoethyl)-N-(pentachlorophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 3426-65-1 | Molecular Weight | 308.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl5N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(Pentachlorophenyl)-1,2-ethanediamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7Cl5N2 |
|---|---|
| Molecular Weight | 308.42000 |
| Exact Mass | 305.90500 |
| PSA | 38.05000 |
| LogP | 5.09750 |
| InChIKey | NKIPRDISYSAKLQ-UHFFFAOYSA-N |
| SMILES | NCCNc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2921590090 |
|---|
|
~%
N-(2-Aminoethyl... CAS#:3426-65-1 |
| Literature: Rocklin Journal of Organic Chemistry, 1956 , vol. 21, p. 1478 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2,2-trichloro-N-pentachloroethyl-acetimidoyl chloride |
| N-pentachlorophenyl-ethylenediamine |
| N-Pentachlorphenyl-aethylendiamin |
| N-Pentachlorethyl-trichloracetimidoylchlorid |