4-(2-prop-2-enylphenoxy)benzene-1,2-dicarbonitrile structure
|
Common Name | 4-(2-prop-2-enylphenoxy)benzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 342651-71-2 | Molecular Weight | 260.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-prop-2-enylphenoxy)benzene-1,2-dicarbonitrile |
|---|
| Molecular Formula | C17H12N2O |
|---|---|
| Molecular Weight | 260.29000 |
| Exact Mass | 260.09500 |
| PSA | 56.81000 |
| LogP | 3.95076 |
| InChIKey | JRWOANKBICMJEU-UHFFFAOYSA-N |
| SMILES | C=CCc1ccccc1Oc1ccc(C#N)c(C#N)c1 |
|
~%
4-(2-prop-2-eny... CAS#:342651-71-2 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US6498249 B1, 2002 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |