1,5-bis(2,6-dimethoxyphenyl)penta-1,4-dien-3-one structure
|
Common Name | 1,5-bis(2,6-dimethoxyphenyl)penta-1,4-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 342808-35-9 | Molecular Weight | 354.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis(2,6-dimethoxyphenyl)penta-1,4-dien-3-one |
|---|
| Molecular Formula | C21H22O5 |
|---|---|
| Molecular Weight | 354.39600 |
| Exact Mass | 354.14700 |
| PSA | 53.99000 |
| LogP | 4.01670 |
| InChIKey | RWGSYJMFOMFSPX-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1C=CC(=O)C=Cc1c(OC)cccc1OC |
|
~72%
1,5-bis(2,6-dim... CAS#:342808-35-9 |
| Literature: Snyder, James P.; Davis, Matthew C.; Adams, Brian; Shoji, Mamoru; Liotta, Dennis C.; Ferstl, Eva M.; Sunay, Ustun B. Patent: US2002/19382 A1, 2002 ; |
|
~%
1,5-bis(2,6-dim... CAS#:342808-35-9 |
| Literature: Jantan, Ibrahim; Bukhari, Syed Nasir Abbas; Lajis, Nordin Haji; Abas, Faridah; Wai, Lam Kok; Jasamai, Malina Journal of Pharmacy and Pharmacology, 2012 , vol. 64, # 3 p. 404 - 412 |