3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde structure
|
Common Name | 3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 342889-39-8 | Molecular Weight | 234.653 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 352.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClFO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8±25.1 °C | |
| Name | 4-(3-Chloro-2-fluorophenyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.2±32.0 °C at 760 mmHg |
| Molecular Formula | C13H8ClFO |
| Molecular Weight | 234.653 |
| Flash Point | 166.8±25.1 °C |
| Exact Mass | 234.024765 |
| PSA | 17.07000 |
| LogP | 4.47 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | LPIFQHGQMIRTBE-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc3c(c2)OCO3)cc1 |
|
~91%
3'-Chloro-2'-fl... CAS#:342889-39-8 |
| Literature: Schneider, Siegfried; Bannwarth, Willi Helvetica Chimica Acta, 2001 , vol. 84, # 3 p. 735 - 742 |
|
~88%
3'-Chloro-2'-fl... CAS#:342889-39-8 |
| Literature: Siamaki, Ali R.; Lin, Yi; Woodberry, Kendra; Connell, John W.; Gupton, B. Frank Journal of Materials Chemistry A, 2013 , vol. 1, # 41 p. 12909 - 12918 |
| 4-(5-Chloro-2-fluorophenyl)benzaldehyde |
| 4-(4-Chloro-2-fluorophenyl)benzaldehyde |
| 3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde |
| 4-(Benzo[1,3]dioxol-5-yl)benzaldehyde |
| Benzaldehyde,4-(1,3-benzodioxol-5-yl) |
| 4-(1,3-Benzodioxol-5-yl)-benzaldehyde |
| 4-formyl-3',4'-methylenedioxybiphenyl |
| [1,1'-Biphenyl]-4-carboxaldehyde, 3'-chloro-2'-fluoro- |