butirosin A
Modify Date: 2025-08-26 10:09:48
butirosin A structure
|
Common Name | butirosin A | ||
|---|---|---|---|---|
| CAS Number | 34291-02-6 | Molecular Weight | 555.57700 | |
| Density | 1.58g/cm3 | Boiling Point | 947.4ºC at 760mmHg | |
| Molecular Formula | C21H41N5O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 526.8ºC | |
| Name | butirosin A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 947.4ºC at 760mmHg |
| Molecular Formula | C21H41N5O12 |
| Molecular Weight | 555.57700 |
| Flash Point | 526.8ºC |
| Exact Mass | 555.27500 |
| PSA | 315.20000 |
| Index of Refraction | 1.657 |
| InChIKey | XEQLFNPSYWZPOW-SVRMBHBBSA-N |
| SMILES | NCCC(O)C(=O)NC1CC(N)C(OC2OC(CN)C(O)C(O)C2N)C(OC2OC(CO)C(O)C2O)C1O |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R61 |
| Safety Phrases | S22;S45;S53;S36/S37/S39 |
|
~99%
butirosin A CAS#:34291-02-6 |
| Literature: Nudelman, Igor; Chen, Lilach; Llewellyn, Nicholas M.; Sahraoui, El-Habib; Cherniavsky, Marina; Spencer, Jonathan B.; Baasova, Timor Advanced Synthesis and Catalysis, 2008 , vol. 350, # 11-12 p. 1682 - 1688 |
| MFCD00078992 |
| butenylmethyldichlorosilane |
| 3-BUTENYLMETHYLDICHLOROSILANE |
| Silane,3-buten-1-yldichloromethyl |
| Silane,3-butenyldichloromethyl-(8CI,9CI) |
| (2S)-4-Amino-N-[(1R,2S,3R,4R,5S)-5-amino-4-[(2,6-diamino-2,6-dide oxy-α-D-glucopyranosyl)oxy]-2-hydroxy-3-(β-D-xylofuranosyloxy)cyc lohexyl]-2-hydroxybutanamide |
| Butirosin B |