Acetamide,N-(7-fluoro-9H-fluoren-2-yl) structure
|
Common Name | Acetamide,N-(7-fluoro-9H-fluoren-2-yl) | ||
|---|---|---|---|---|
| CAS Number | 343-89-5 | Molecular Weight | 241.26000 | |
| Density | 1.299g/cm3 | Boiling Point | 466.4ºC at 760mmHg | |
| Molecular Formula | C15H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | N-(7-fluoro-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760mmHg |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.26000 |
| Flash Point | 235.9ºC |
| Exact Mass | 241.09000 |
| PSA | 32.59000 |
| LogP | 4.00480 |
| Index of Refraction | 1.654 |
| InChIKey | UAGZFYAGROGZQW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)Cc1cc(F)ccc1-2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Carcinogenic activity on mixed data after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771340
|
|
Name: Carcinogenic activity on breast after oral administration of the compound
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770577
|
|
Name: Carcinogenic activity on ear duct after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771496
|
|
Name: Carcinogenic activity after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770717
|
|
Name: Carcinogenic activity on all sites after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL770414
|
|
Name: Carcinogenic activity on liver after oral administration
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL771451
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| ACETAMIDE,N-(7-FLUOROFLUOREN-2-YL) |
| N-(7-Fluor-fluoren-2-yl)-acetamid |
| 7-Fluoro-2-acetylaminofluorene |
| N-2-<7-Fluor-fluorenyl>-acetamid |
| 7-Fluoro-2-acetamido-fluorene |
| N-2-Acetylamino-7-fluorofluorene |
| N-(7-Fluorofluoren-2-yl)acetamide |
| 2-ACETAMIDO-7-FLUOROFLUORENE |
| 7-Fluoro-N-2-acetylaminofluorene |