butane,cadmium(2+)
butane,cadmium(2+) structure
|
Common Name | butane,cadmium(2+) | ||
|---|---|---|---|---|
| CAS Number | 3431-67-2 | Molecular Weight | 226.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18Cd | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butane,cadmium(2+) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18Cd |
|---|---|
| Molecular Weight | 226.64000 |
| Exact Mass | 228.04400 |
| LogP | 3.23870 |
| InChIKey | TVBDZBRVOTXUJM-UHFFFAOYSA-N |
| SMILES | [CH2-]CCC.[CH2-]CCC.[Cd+2] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
butane,cadmium(2+) CAS#:3431-67-2 |
| Literature: Krause Chemische Berichte, 1917 , vol. 50, p. 1817 |
|
~%
butane,cadmium(2+) CAS#:3431-67-2 |
| Literature: Hock; Ernst Chemische Berichte, 1959 , vol. 92, p. 2732,2738 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 10 | |
CAS#:4144-61-0
CAS#:37174-96-2
CAS#:33083-83-9
CAS#:3637-15-8
CAS#:5582-82-1
CAS#:551-08-6
CAS#:502-56-7
CAS#:59373-69-2
CAS#:4447-64-7
CAS#:20754-04-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| di-n-butylcadmium |
| Cadmium,dibutyl |
| dibutylcadmium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of butane,cadmium(2+)? |
| A: SMILES notation of butane,cadmium(2+) is [CH2-]CCC.[CH2-]CCC.[Cd+2]. |
| Q: What is the CAS number of butane,cadmium(2+)? |
| A: CAS number of butane,cadmium(2+) is 3431-67-2. |
| Q: What are the upstream materials of butane,cadmium(2+)? |
| A: Related upstream materials(CAS) of butane,cadmium(2+): 693-03-8;693-04-9. |
| Q: What English synonyms does butane,cadmium(2+) have? |
| A: English synonyms of butane,cadmium(2+): di-n-butylcadmium, Cadmium,dibutyl, dibutylcadmium. |
| Q: What is the molecular formula of butane,cadmium(2+)? |
| A: Molecular formula of butane,cadmium(2+) is C8H18Cd. |
| Q: What is the LogP of butane,cadmium(2+)? |
| A: LogP of butane,cadmium(2+) is 3.23870. |
| Q: What is the molecular weight of butane,cadmium(2+)? |
| A: Molecular weight of butane,cadmium(2+) is 226.64000. |
| Q: What is the Chinese name of 3431-67-2? |
| A: Chinese name of 3431-67-2 is 3431-67-2. |
| Q: What is the English name of butane,cadmium(2+)? |
| A: The English name of butane,cadmium(2+) is butane,cadmium(2+). |
| Q: What is the InChIKey of butane,cadmium(2+)? |
| A: InChIKey of butane,cadmium(2+) is TVBDZBRVOTXUJM-UHFFFAOYSA-N. |