N-methyl-2-(4-methylphenyl)succinimide structure
|
Common Name | N-methyl-2-(4-methylphenyl)succinimide | ||
|---|---|---|---|---|
| CAS Number | 34319-19-2 | Molecular Weight | 203.23700 | |
| Density | 1.173g/cm3 | Boiling Point | 367.1ºC at 760mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 1-methyl-3-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 367.1ºC at 760mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 169.7ºC |
| Exact Mass | 203.09500 |
| PSA | 37.38000 |
| LogP | 1.40520 |
| Index of Refraction | 1.562 |
| InChIKey | ZTWJSSIJGHUYLK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2CC(=O)N(C)C2=O)cc1 |
| HS Code | 2925190090 |
|---|
|
~60%
N-methyl-2-(4-m... CAS#:34319-19-2 |
| Literature: Lange; Rump; Borkowska; Kowalczyk; Lapszewicz; Migaj; Walczyna Pharmazie, 1984 , vol. 39, # 5 p. 318 - 319 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-methyl-3-p-tolyl-pyrrolidine-2,5-dione |