a-D-Glucopyranoside, methyl6-deoxy-6-iodo-, 3,4-dibenzoate 2-(4-methylbenzenesulfonate) structure
|
Common Name | a-D-Glucopyranoside, methyl6-deoxy-6-iodo-, 3,4-dibenzoate 2-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 34340-09-5 | Molecular Weight | 666.47800 | |
| Density | 1.59g/cm3 | Boiling Point | 718.2ºC at 760mmHg | |
| Molecular Formula | C28H27IO9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.2ºC | |
| Name | [4-benzoyloxy-2-(iodomethyl)-6-methoxy-5-(4-methylphenyl)sulfonyloxyoxan-3-yl] benzoate |
|---|
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 718.2ºC at 760mmHg |
| Molecular Formula | C28H27IO9S |
| Molecular Weight | 666.47800 |
| Flash Point | 388.2ºC |
| Exact Mass | 666.04200 |
| PSA | 122.81000 |
| LogP | 5.40720 |
| Index of Refraction | 1.641 |
| InChIKey | GXTSCYPKSHTHHT-UHFFFAOYSA-N |
| SMILES | COC1OC(CI)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OS(=O)(=O)c1ccc(C)cc1 |
|
~92%
a-D-Glucopyrano... CAS#:34340-09-5 |
| Literature: Bauder, Claude Organic and Biomolecular Chemistry, 2008 , vol. 6, # 16 p. 2952 - 2960 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |