Isopropyl 3-Amino-4-Chlorobenzoate structure
|
Common Name | Isopropyl 3-Amino-4-Chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 343773-02-4 | Molecular Weight | 213.66100 | |
| Density | 1.221g/cm3 | Boiling Point | 313.292ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.274ºC | |
| Name | propan-2-yl 3-amino-4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 313.292ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66100 |
| Flash Point | 143.274ºC |
| Exact Mass | 213.05600 |
| PSA | 52.32000 |
| LogP | 3.06860 |
| Index of Refraction | 1.558 |
| InChIKey | MODGZMKPTCPKSN-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccc(Cl)c(N)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Isopropyl 3-amino-4-chlorobenzoate |