5-Methoxy-7-methyl-1H-indole-2,3-dione structure
|
Common Name | 5-Methoxy-7-methyl-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 343774-48-1 | Molecular Weight | 191.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-7-methyl-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.183 |
| Exact Mass | 191.058243 |
| PSA | 55.40000 |
| LogP | 0.93 |
| Index of Refraction | 1.576 |
| InChIKey | PROWQPRZTYDRFQ-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c2c(c1)C(=O)C(=O)N2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methoxy-7-methylindoline-2,3-dione |
| CTK8I3106 |
| 7-Methyl-5-methoxy indole-2,3-dione |
| 7-Methyl-5-methoxy isatin 7-Methyl-5-methoxy indole-2,3-dione |
| 5-methoxy-7-methyl-isatine |
| 5-Methoxy-7-methyl-1H-indole-2,3-dione |
| 1H-Indole-2,3-dione, 5-methoxy-7-methyl- |