1H-Imidazo[4,5-d]pyridazine-4,7-dione, 2,3,5,6-tetrahydro-1-(phenylmethyl)-2-thioxo- structure
|
Common Name | 1H-Imidazo[4,5-d]pyridazine-4,7-dione, 2,3,5,6-tetrahydro-1-(phenylmethyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 3438-72-0 | Molecular Weight | 274.29800 | |
| Density | 1.58g/cm3 | Boiling Point | 667.1ºC at 760 mmHg | |
| Molecular Formula | C12H10N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.3ºC | |
| Name | 3-benzyl-2-sulfanylidene-5,6-dihydro-1H-imidazo[4,5-d]pyridazine-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 667.1ºC at 760 mmHg |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.29800 |
| Flash Point | 357.3ºC |
| Exact Mass | 274.05200 |
| PSA | 118.53000 |
| LogP | 1.12380 |
| Index of Refraction | 1.772 |
| InChIKey | UOKDZZRHBUPEQL-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c(=O)c2c1[nH]c(=S)n2Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Imidazo[4,5-d]pyridazine-4,7-dione,2,3,5,6-tetrahydro-1-(phenylmethyl)-2-thioxo |
| HMS3080A11 |
| 1-benzyl-2-thioxo-2,3,5,6-tetrahydro-1H-imidazo[4,5-d]pyridazine-4,7-dione |
| 4,7-Dihydroxy-2-mercapto-1-benzyl-1H-imidazo<4,5-d>pyridazin |