2H-Imidazo[4,5-d]pyridazine-2-thione, 1,3-dihydro-4,7-dimercapto-1-(phenylmethyl)- structure
|
Common Name | 2H-Imidazo[4,5-d]pyridazine-2-thione, 1,3-dihydro-4,7-dimercapto-1-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3438-74-2 | Molecular Weight | 306.43000 | |
| Density | 1.61g/cm3 | Boiling Point | 431.7ºC at 760 mmHg | |
| Molecular Formula | C12H10N4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 3-benzyl-5,6-dihydro-1H-imidazo[4,5-d]pyridazine-2,4,7-trithione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760 mmHg |
| Molecular Formula | C12H10N4S3 |
| Molecular Weight | 306.43000 |
| Flash Point | 214.9ºC |
| Exact Mass | 306.00700 |
| PSA | 148.57000 |
| LogP | 3.86240 |
| Index of Refraction | 1.871 |
| InChIKey | ZEVCDJNCIXGPTA-UHFFFAOYSA-N |
| SMILES | S=c1[nH][nH]c(=S)c2c1[nH]c(=S)n2Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4,7-Trimercapto-1-benzyl-1H-imidazo<4,5-d>pyridazin |