1-amino-3-chloro-4-hydroxy-2-phenoxyanthracene-9,10-dione structure
|
Common Name | 1-amino-3-chloro-4-hydroxy-2-phenoxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 34391-96-3 | Molecular Weight | 365.76700 | |
| Density | 1.509g/cm3 | Boiling Point | 578.8ºC at 760mmHg | |
| Molecular Formula | C20H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.8ºC | |
| Name | 1-amino-3-chloro-4-hydroxy-2-phenoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.509g/cm3 |
|---|---|
| Boiling Point | 578.8ºC at 760mmHg |
| Molecular Formula | C20H12ClNO4 |
| Molecular Weight | 365.76700 |
| Flash Point | 303.8ºC |
| Exact Mass | 365.04500 |
| PSA | 89.62000 |
| LogP | 4.77670 |
| Index of Refraction | 1.724 |
| InChIKey | JYEYYBHLLCRINZ-UHFFFAOYSA-N |
| SMILES | Nc1c(Oc2ccccc2)c(Cl)c(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Amino-3-chloro-4-hydroxy-2-phenoxyanthraquinone |
| 1-amino-3-chloro-4-hydroxy-2-phenoxy-9,10-anthraquinone |
| EINECS 251-988-7 |