Dimethyl(diphenoxy)silane structure
|
Common Name | Dimethyl(diphenoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 3440-02-6 | Molecular Weight | 244.361 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 286.6±13.0 °C at 760 mmHg | |
| Molecular Formula | C14H16O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1±7.4 °C | |
| Name | Dimethyl(diphenoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 286.6±13.0 °C at 760 mmHg |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.361 |
| Flash Point | 159.1±7.4 °C |
| Exact Mass | 244.091949 |
| PSA | 18.46000 |
| LogP | 5.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | SWLVAJXQIOKFSJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Oc1ccccc1)Oc1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 222-346-3 |
| silane, dimethyldiphenoxy- |
| silane,dimethyldiphenoxy |
| Benzene, 1,1'-[(dimethylsilylene)bis(oxy)]bis- |
| Dimethyl(diphenoxy)silane |
| Diphenoxy(dimethyl)silan |
| Dimethyl-diphenoxy-silan |
| dimethyldiphenoxysilane |