8-methylsulfanyl-7H-purine structure
|
Common Name | 8-methylsulfanyl-7H-purine | ||
|---|---|---|---|---|
| CAS Number | 34403-87-7 | Molecular Weight | 549.05700 | |
| Density | 1.38g/cm3 | Boiling Point | 785.7ºC at 760 mmHg | |
| Molecular Formula | C31H33ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 429ºC | |
| Name | 8-methylsulfanyl-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 785.7ºC at 760 mmHg |
| Molecular Formula | C31H33ClN2O5 |
| Molecular Weight | 549.05700 |
| Flash Point | 429ºC |
| Exact Mass | 548.20800 |
| PSA | 68.31000 |
| LogP | 4.10710 |
| Index of Refraction | 1.664 |
| InChIKey | HSQGPMQTEPQWGD-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C1(CCCl)C3CC4C(=CCOC5CC(=O)N2C1C54)CN3C(=O)Cc1ccccc1 |
|
~%
8-methylsulfany... CAS#:34403-87-7 |
| Literature: Dickstein,J.I.; Miller,S.I. Journal of Organic Chemistry, 1972 , vol. 37, # 13 p. 2175 - 2180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Octadecanoic acid,18-bromo |
| 18-bromo-octadecanoic acid |
| 18-chloro-2,3-dimethoxy-19-phenylacetyl-18,19-seco-strychnidin-10-one |
| 18-Chlor-19-phenylacetyl-18,19-secobrucin |
| 18-Brom-octadecansaeure |