boc-l-dab(boc) structure
|
Common Name | boc-l-dab(boc) | ||
|---|---|---|---|---|
| CAS Number | 34404-27-8 | Molecular Weight | 318.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | boc-l-dab(boc) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26N2O6 |
|---|---|
| Molecular Weight | 318.36600 |
| Exact Mass | 318.17900 |
| PSA | 113.96000 |
| LogP | 2.66090 |
| InChIKey | JIYZOHCBABALOE-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(NC(=O)OC(C)(C)C)C(=O)O |
| HS Code | 2924199090 |
|---|
|
~%
boc-l-dab(boc) CAS#:34404-27-8 |
| Literature: Csuk, Rene; Schwarz, Stefan; Siewert, Bianka; Kluge, Ralph; Stroehl, Dieter Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2012 , vol. 67, # 7 p. 731 - 746 |
|
~%
boc-l-dab(boc) CAS#:34404-27-8 |
| Literature: Ma, Sang-ho; Yoon, Doo Ha; Ha, Hyun-Joon; Lee, Won Koo Tetrahedron Letters, 2007 , vol. 48, # 2 p. 269 - 271 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-2,4-di-t-butyloxycarbonyldiaminobutanoic acid |
| N,N'-di-(tert-butoxycarbonyl)-2,4-diaminobutanoic acid |
| (S)-2,4-Bis((tert-butoxycarbonyl)amino)butanoic acid |
| (2S)-2,4-bis[(tert-butoxycarbonyl)amino]butyric acid |
| (S)-2,4-bis(tert-butoxycarbonyl)butanoic acid |
| Boc-L-Dab(Boc)-OH |
| (S)-2,4-BIS-TERT-BUTOXYCARBONYLAMINO-BUTYRIC ACID |