Methyl 3-(dimethylamino)-4-methoxybenzoate structure
|
Common Name | Methyl 3-(dimethylamino)-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 344332-16-7 | Molecular Weight | 209.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-(dimethylamino)-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24200 |
| Exact Mass | 209.10500 |
| PSA | 38.77000 |
| LogP | 1.54780 |
| InChIKey | GHXNUPBZXUAPNM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c(N(C)C)c1 |
| HS Code | 2922509090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Dimethylamino-4-methoxy-benzoesaeure-methylester |
| methyl 3-dimethylamino-4-methoxybenzoate |
| methyl 3-N,N-dimethylamino-4-methoxybenzoate |
| 3-dimethylamino-4-methoxy-benzoic acid methyl ester |
| 3-Dimethylamino-anissaeure-methylester |