3-(Phenylsulfonyl)propanoyl chloride structure
|
Common Name | 3-(Phenylsulfonyl)propanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3445-53-2 | Molecular Weight | 232.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(benzenesulfonyl)propanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9ClO3S |
|---|---|
| Molecular Weight | 232.68400 |
| Exact Mass | 231.99600 |
| PSA | 59.59000 |
| LogP | 2.69660 |
| InChIKey | QPZGKMLYCRNKCK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CCS(=O)(=O)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
3-(Phenylsulfon... CAS#:3445-53-2 |
| Literature: Andreini, Manuel; Doknic, Daniela; Sutkeviciute, Ieva; Reina, Jose J.; Duan, Janxin; Chabrol, Eric; Thepaut, Michel; Moroni, Elisabetta; Doro, Fabio; Belvisi, Laura; Weiser, Joerg; Rojo, Javier; Fieschi, Franck; Bernardi, Anna Organic and Biomolecular Chemistry, 2011 , vol. 9, # 16 p. 5778 - 5786 |
|
~%
3-(Phenylsulfon... CAS#:3445-53-2 |
| Literature: Durst,T. et al. Canadian Journal of Chemistry, 1973 , vol. 51, p. 1704 - 1712 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Phenylsulfonyl-propionylchlorid |
| F2146-0416 |
| 3-(benzenesulphonyl)propionyl chloride |
| 3-(phenylsulfonyl)-propanoyl chloride |
| 3-(phenylsulfonyl)propionyl chloride |