1,1,1,3,3,3-hexafluoro-N-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-yl]propan-2-imine structure
|
Common Name | 1,1,1,3,3,3-hexafluoro-N-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-yl]propan-2-imine | ||
|---|---|---|---|---|
| CAS Number | 34451-14-4 | Molecular Weight | 478.08100 | |
| Density | 1.72g/cm3 | Boiling Point | 77.8ºC at 760 mmHg | |
| Molecular Formula | C9F18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 0.9ºC | |
| Name | 1,1,1,3,3,3-hexafluoro-N-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-yl]propan-2-imine |
|---|
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 77.8ºC at 760 mmHg |
| Molecular Formula | C9F18N2 |
| Molecular Weight | 478.08100 |
| Flash Point | 0.9ºC |
| Exact Mass | 477.97700 |
| PSA | 24.72000 |
| LogP | 5.93850 |
| Index of Refraction | 1.298 |
| InChIKey | DGFCPCSSMQXTKY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=NC(N=C(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
|
~50%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 8, page 125 - 158 |
|
~39%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 8, page 125 - 158 |
|
~%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Swindell,R.F.; Shreeve,J.M. Journal of the American Chemical Society, 1972 , vol. 94, p. 5713 - 5718 |
|
~%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 8, page 125 - 158 |
|
~%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 8, page 125 - 158 |
|
~%
1,1,1,3,3,3-hex... CAS#:34451-14-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 8, page 125 - 158 |