2-Amino-N-(2-bromophenyl)benzamide structure
|
Common Name | 2-Amino-N-(2-bromophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 34489-85-5 | Molecular Weight | 291.143 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 350.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9±23.7 °C | |
| Name | 2-amino-n-(2-bromophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.7±27.0 °C at 760 mmHg |
| Molecular Formula | C13H11BrN2O |
| Molecular Weight | 291.143 |
| Flash Point | 165.9±23.7 °C |
| Exact Mass | 290.005463 |
| PSA | 55.12000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | KNSXPWPBPXHJHV-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)Nc1ccccc1Br |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-N-(2-bromophenyl)benzamide |