N-[[5-[(2,4-dinitrophenyl)hydrazinylidene]-3-ethyl-pentylidene]amino]-2,4-dinitro-aniline structure
|
Common Name | N-[[5-[(2,4-dinitrophenyl)hydrazinylidene]-3-ethyl-pentylidene]amino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 3449-36-3 | Molecular Weight | 488.41100 | |
| Density | 1.52g/cm3 | Boiling Point | 684.5ºC at 760 mmHg | |
| Molecular Formula | C19H20N8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.8ºC | |
| Name | N-[[5-[(2,4-dinitrophenyl)hydrazinylidene]-3-ethylpentylidene]amino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 684.5ºC at 760 mmHg |
| Molecular Formula | C19H20N8O8 |
| Molecular Weight | 488.41100 |
| Flash Point | 367.8ºC |
| Exact Mass | 488.14000 |
| PSA | 232.06000 |
| LogP | 6.86020 |
| Index of Refraction | 1.669 |
| InChIKey | ZLBNFRLRVHVXSK-VDEHPEQNSA-N |
| SMILES | CCC(CC=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
|
~%
N-[[5-[(2,4-din... CAS#:3449-36-3 |
| Literature: Dey,A.S.; Joullie,M.M. Journal of Organic Chemistry, 1965 , vol. 30, p. 3237 - 3239 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Aethyl-fluoranthen |
| 3-Aethyl-glutaraldehyd-bis-<2,4-dinitro-phenyl-hydrazon> |
| 4-Aethylfluoranthen |
| Fluoranthene,3-ethyl |