diethyl 2,6-dihydroxy-4-(4-methoxyphenyl)-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate structure
|
Common Name | diethyl 2,6-dihydroxy-4-(4-methoxyphenyl)-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 3449-42-1 | Molecular Weight | 504.37400 | |
| Density | 1.437g/cm3 | Boiling Point | 505.9ºC at 760 mmHg | |
| Molecular Formula | C20H22F6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | diethyl 2,6-dihydroxy-4-(4-methoxyphenyl)-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate |
|---|
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 505.9ºC at 760 mmHg |
| Molecular Formula | C20H22F6O8 |
| Molecular Weight | 504.37400 |
| Flash Point | 259.7ºC |
| Exact Mass | 504.12200 |
| PSA | 111.52000 |
| LogP | 2.66940 |
| Index of Refraction | 1.479 |
| InChIKey | ZWCDTIWOHIYUPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(c2ccc(OC)cc2)C(C(=O)OCC)C(O)(C(F)(F)F)OC1(O)C(F)(F)F |
|
~67%
diethyl 2,6-dih... CAS#:3449-42-1 |
| Literature: Zlotin; Kryshtal'; Zhdankina; Ignatenko; Burgart; Saloutin; Chupakhin Russian Journal of Organic Chemistry, 2010 , vol. 46, # 4 p. 468 - 473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |