diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate structure
|
Common Name | diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 3449-44-3 | Molecular Weight | 474.34800 | |
| Density | 1.451g/cm3 | Boiling Point | 475ºC at 760 mmHg | |
| Molecular Formula | C19H20F6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1ºC | |
| Name | diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(trifluoromethyl)oxane-3,5-dicarboxylate |
|---|
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 475ºC at 760 mmHg |
| Molecular Formula | C19H20F6O7 |
| Molecular Weight | 474.34800 |
| Flash Point | 241.1ºC |
| Exact Mass | 474.11100 |
| PSA | 102.29000 |
| LogP | 2.66080 |
| Index of Refraction | 1.479 |
| InChIKey | QWUSIZYVFVVWSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(c2ccccc2)C(C(=O)OCC)C(O)(C(F)(F)F)OC1(O)C(F)(F)F |
|
~74%
diethyl 2,6-dih... CAS#:3449-44-3 |
| Literature: Zlotin; Kryshtal'; Zhdankina; Ignatenko; Burgart; Saloutin; Chupakhin Russian Journal of Organic Chemistry, 2010 , vol. 46, # 4 p. 468 - 473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |