Phosphonic acid,(1-hydroxyheptyl)-, diethyl ester, acetate (7CI,8CI) structure
|
Common Name | Phosphonic acid,(1-hydroxyheptyl)-, diethyl ester, acetate (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3449-94-3 | Molecular Weight | 294.32400 | |
| Density | 1.036g/cm3 | Boiling Point | 362.2ºC at 760mmHg | |
| Molecular Formula | C13H27O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 1-diethoxyphosphorylheptyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 362.2ºC at 760mmHg |
| Molecular Formula | C13H27O5P |
| Molecular Weight | 294.32400 |
| Flash Point | 186.5ºC |
| Exact Mass | 294.16000 |
| PSA | 71.64000 |
| LogP | 4.11210 |
| Index of Refraction | 1.437 |
| InChIKey | CAKNEATXKDPGPN-UHFFFAOYSA-N |
| SMILES | CCCCCCC(OC(C)=O)P(=O)(OCC)OCC |
|
~%
Phosphonic acid... CAS#:3449-94-3 |
| Literature: Hafner; Brown; Garrison; Alexander Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 730 - 731 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(diethoxyphosphoryl)heptyl acetate |
| <1-Acetoxy-heptylphosphonsaeure>-diaethylester |