Benzene,1-fluoro-2,4-dimethyl-5-nitro
Benzene,1-fluoro-2,4-dimethyl-5-nitro structure
|
Common Name | Benzene,1-fluoro-2,4-dimethyl-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 345-22-2 | Molecular Weight | 169.15300 | |
| Density | 1.225g/cm3 | Boiling Point | 247.6ºC at 760mmHg | |
| Molecular Formula | C8H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-fluoro-2,4-dimethyl-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 247.6ºC at 760mmHg |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.15300 |
| Flash Point | 103.5ºC |
| Exact Mass | 169.05400 |
| PSA | 45.82000 |
| LogP | 2.87390 |
| Index of Refraction | 1.527 |
| InChIKey | WHXPEFPOIQDRJZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:444-02-0
CAS#:389-46-8
CAS#:400-02-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-fluoro-2,4-dimethyl-5-nitro-benzene |
| 1-Fluor-2,4-dimethyl-5-nitro-benzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: Related downstream products(CAS) of 1-fluoro-2,4-dimethyl-5-nitrobenzene: 444-02-0;389-46-8;400-02-2. |
| Q: What English synonyms does 1-fluoro-2,4-dimethyl-5-nitrobenzene have? |
| A: English synonyms of 1-fluoro-2,4-dimethyl-5-nitrobenzene: 1-fluoro-2,4-dimethyl-5-nitro-benzene, 1-Fluor-2,4-dimethyl-5-nitro-benzol. |
| Q: What is the polar surface area (PSA) of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: Polar surface area (PSA) of 1-fluoro-2,4-dimethyl-5-nitrobenzene is 45.82000. |
| Q: What is the English name of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: The English name of 1-fluoro-2,4-dimethyl-5-nitrobenzene is 1-fluoro-2,4-dimethyl-5-nitrobenzene. |
| Q: What is the InChIKey of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: InChIKey of 1-fluoro-2,4-dimethyl-5-nitrobenzene is WHXPEFPOIQDRJZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: CAS number of 1-fluoro-2,4-dimethyl-5-nitrobenzene is 345-22-2. |
| Q: What is the SMILES notation of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: SMILES notation of 1-fluoro-2,4-dimethyl-5-nitrobenzene is Cc1cc(C)c([N+](=O)[O-])cc1F. |
| Q: What is the LogP of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: LogP of 1-fluoro-2,4-dimethyl-5-nitrobenzene is 2.87390. |
| Q: What is the molecular formula of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: Molecular formula of 1-fluoro-2,4-dimethyl-5-nitrobenzene is C8H8FNO2. |
| Q: What is the molecular weight of 1-fluoro-2,4-dimethyl-5-nitrobenzene? |
| A: Molecular weight of 1-fluoro-2,4-dimethyl-5-nitrobenzene is 169.15300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |