2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone
Modify Date: 2026-07-09 11:16:55
2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone structure
|
Common Name | 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 345-74-4 | Molecular Weight | 320.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9FN4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9FN4O5 |
|---|---|
| Molecular Weight | 320.23 |
| InChIKey | FQYPPBNDSACPCG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C=NNc2ccccc2)c(F)c([N+](=O)[O-])c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: The English name of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone. |
| Q: What is the SMILES notation of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: SMILES notation of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is O=[N+]([O-])c1cc(C=NNc2ccccc2)c(F)c([N+](=O)[O-])c1O. |
| Q: What is the molecular weight of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: Molecular weight of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is 320.23. |
| Q: What is the molecular formula of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: Molecular formula of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is C13H9FN4O5. |
| Q: What is the InChIKey of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: InChIKey of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is FQYPPBNDSACPCG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 345-74-4? |
| A: Chinese name of 345-74-4 is 345-74-4. |
| Q: What is the CAS number of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone? |
| A: CAS number of 2-Fluoro-4-hydroxy-3,5-dinitrobenzaldehyde 2-phenylhydrazone is 345-74-4. |