bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane
bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane structure
|
Common Name | bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 34501-61-6 | Molecular Weight | 380.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H33Si3Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H33Si3Sn |
|---|---|
| Molecular Weight | 380.34800 |
| Exact Mass | 381.09100 |
| LogP | 5.11340 |
| InChIKey | OZHDFDSTDHFESI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C[SnH](C[Si](C)(C)C)C[Si](C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
bis(trimethylsi... CAS#:34501-61-6 |
| Literature: Gmelin Handbook: Sn: Org.Verb.4, 1.2.1.1.6, page 66 - 69 |
|
~66%
bis(trimethylsi... CAS#:34501-61-6 |
| Literature: Gmelin Handbook: Sn: Org.Verb.4, 1.2.1.1.6, page 66 - 69 |
![[chloro-bis(trimethylsilylmethyl)stannyl]methyl-trimethylsilane structure](https://image.chemsrc.com/caspic/427/34570-67-7.png)
![[Tris[(trimethylsilyl)methyl]stannyl]lithium structure](https://image.chemsrc.com/caspic/018/51523-14-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: Molecular weight of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is 380.34800. |
| Q: What is the Chinese name of 34501-61-6? |
| A: Chinese name of 34501-61-6 is 34501-61-6. |
| Q: What is the CAS number of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: CAS number of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is 34501-61-6. |
| Q: What is the English name of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: The English name of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane. |
| Q: What is the molecular formula of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: Molecular formula of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is C12H33Si3Sn. |
| Q: What is the SMILES notation of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: SMILES notation of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is C[Si](C)(C)C[SnH](C[Si](C)(C)C)C[Si](C)(C)C. |
| Q: What are the upstream materials of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: Related upstream materials(CAS) of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane: 16853-85-3;34570-67-7;51523-14-9;507-20-0. |
| Q: What is the LogP of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: LogP of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is 5.11340. |
| Q: What is the InChIKey of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane? |
| A: InChIKey of bis(trimethylsilylmethyl)stannylmethyl-trimethylsilane is OZHDFDSTDHFESI-UHFFFAOYSA-N. |