tert-Butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate structure
|
Common Name | tert-Butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 345311-03-7 | Molecular Weight | 223.272 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 383.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8±25.9 °C | |
| Name | tert-butyl 6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.6±35.0 °C at 760 mmHg |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.272 |
| Flash Point | 185.8±25.9 °C |
| Exact Mass | 223.132080 |
| PSA | 47.36000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | WDHIKONIOJKMIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCn2ccnc2C1 |
| HS Code | 2933990090 |
|---|
|
~36%
tert-Butyl 5,6-... CAS#:345311-03-7 |
| Literature: Castro Pineiro, Jose Luis; Dinnell, Kevin; Elliott, Jason Matthew; Hollingworth, Gregory John; Shaw, Duncan Edward; Swain, Christopher John Patent: US2003/236250 A1, 2003 ; Location in patent: Page 40 ; |
|
~%
tert-Butyl 5,6-... CAS#:345311-03-7 |
| Literature: WO2010/125101 A1, ; Page/Page column 58-59 ; WO 2010/125101 A1 |
|
~%
tert-Butyl 5,6-... CAS#:345311-03-7 |
| Literature: WO2009/158394 A1, ; Page/Page column 69; 71 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Boc-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| 5,6-Dihydro-8H-imidazo[1,2-a]pyrazine-7-carboxylic acid tert-butyl ester |
| 1,1-dimethylethyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate |
| tert-Butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate |
| Imidazo[1,2-a]pyrazine-7(8H)-carboxylic acid, 5,6-dihydro-, 1,1-dimethylethyl ester |
| SC2671 |
| 2-Methyl-2-propanyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate |
| 1,1-dimethylethyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-7-carboxylate |