5-[2-(4-nitrophenyl)ethyl]-3H-1,3,4-oxadiazol-2-one structure
|
Common Name | 5-[2-(4-nitrophenyl)ethyl]-3H-1,3,4-oxadiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 34544-61-1 | Molecular Weight | 235.19600 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[2-(4-nitrophenyl)ethyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.19600 |
| Exact Mass | 235.05900 |
| PSA | 104.71000 |
| LogP | 1.57950 |
| Index of Refraction | 1.663 |
| InChIKey | LLNLGLNMGYSBMA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(CCc2ccc([N+](=O)[O-])cc2)o1 |
|
~%
5-[2-(4-nitroph... CAS#:34544-61-1 |
| Literature: Rosen,G.M. et al. Journal of Heterocyclic Chemistry, 1971 , vol. 8, p. 659 - 662 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-[2-(4-nitrophenyl)ethyl]-1,3,4-oxadiazol-2(3h)-one |
| 5-(4-nitro-phenethyl)-3H-[1,3,4]oxadiazol-2-one |