2-(diethoxymethyl)-5-nitrofuran structure
|
Common Name | 2-(diethoxymethyl)-5-nitrofuran | ||
|---|---|---|---|---|
| CAS Number | 3455-50-3 | Molecular Weight | 215.20300 | |
| Density | 1.196g/cm3 | Boiling Point | 231.2ºC at 760 mmHg | |
| Molecular Formula | C9H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.6ºC | |
| Name | 2-(diethoxymethyl)-5-nitrofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 231.2ºC at 760 mmHg |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20300 |
| Flash Point | 93.6ºC |
| Exact Mass | 215.07900 |
| PSA | 77.42000 |
| LogP | 2.78260 |
| Index of Refraction | 1.49 |
| InChIKey | KCOCEYGKBVVPDC-UHFFFAOYSA-N |
| SMILES | CCOC(OCC)c1ccc([N+](=O)[O-])o1 |
| HS Code | 2932190090 |
|---|
|
~%
2-(diethoxymeth... CAS#:3455-50-3 |
| Literature: Saikachi; Ogawa Journal of the American Chemical Society, 1958 , vol. 80, p. 3642 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Nitro-furfural-diaethylacetal |
| 2-diethoxymethyl-5-nitro-furan |
| 5-nitro-furfural-diethylacetal |
| Nifuratel Impurity 4 |