Pentamethylene nitrate structure
|
Common Name | Pentamethylene nitrate | ||
|---|---|---|---|---|
| CAS Number | 3457-92-9 | Molecular Weight | 194.14300 | |
| Density | 1.299g/cm3 | Boiling Point | 274.4ºC at 760mmHg | |
| Molecular Formula | C5H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.4ºC | |
| Name | 5-nitrooxypentyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 274.4ºC at 760mmHg |
| Molecular Formula | C5H10N2O6 |
| Molecular Weight | 194.14300 |
| Flash Point | 127.4ºC |
| Exact Mass | 194.05400 |
| PSA | 110.10000 |
| LogP | 1.61970 |
| Index of Refraction | 1.457 |
| InChIKey | MIYIEPHJPVBSEV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCCCCO[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~84%
Pentamethylene ... CAS#:3457-92-9 |
| Literature: DSM IP ASSETS B.V.; Duval, Stephane; Kindermann, Maik Patent: US2014/147529 A1, 2014 ; Location in patent: Paragraph 0136; 0137 ; |
|
~%
Pentamethylene ... CAS#:3457-92-9 |
| Literature: Kemp et al. Journal of Physical Chemistry, 1957 , vol. 61, p. 240 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,5-Bis-nitryloxy-pentan |
| 1,5-Pentanediol,dinitrate |
| nitric acid pentanediyl ester |
| 1,5-bis-nitrooxy-pentane |
| Pentandiyl-dinitrat |
| pentane-1,5-diyl dinitrate |
| Salpetersaeure-pentandiylester |
| Pentamethylene dinitrate |