3,7-Dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride structure
|
Common Name | 3,7-Dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 34576-80-2 | Molecular Weight | 295.57000 | |
| Density | 1.577g/cm3 | Boiling Point | 408.3ºC at 760mmHg | |
| Molecular Formula | C10H5Cl3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.7ºC | |
| Name | 3,7-Dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 408.3ºC at 760mmHg |
| Molecular Formula | C10H5Cl3O2S |
| Molecular Weight | 295.57000 |
| Flash Point | 200.7ºC |
| Exact Mass | 293.90800 |
| PSA | 54.54000 |
| LogP | 4.59570 |
| Index of Refraction | 1.66 |
| InChIKey | RYIXVDARTFRZDX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(Cl)c(C(=O)Cl)sc2c1Cl |
| RIDADR | UN3261 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2934999090 |
|
~73%
3,7-Dichloro-6-... CAS#:34576-80-2 |
| Literature: Connor; Cetenko; Mullican; Sorenson; Unangst; Weikert; Adolphson; Kennedy; Thueson; Wright; Conroy Journal of Medicinal Chemistry, 1992 , vol. 35, # 5 p. 958 - 965 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlorcarbonyl-3,7-dichlor-6-methoxybenzo<b>thiophen |
| 6-Methoxy-7,3-Dichlorobenzo[b]thiophene-2-Carbonyl Chloride |
| 3,7-Dichloro-6-methoxybenzo[b]thiophene-2-carbonyl chloride |