3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride structure
|
Common Name | 3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 34576-82-4 | Molecular Weight | 276.09600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H3Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Chloro-6-nitro-1-benzothiophene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H3Cl2NO3S |
|---|---|
| Molecular Weight | 276.09600 |
| Exact Mass | 274.92100 |
| PSA | 91.13000 |
| LogP | 4.36510 |
| InChIKey | GHFFWMJYYLDQHG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1sc2cc([N+](=O)[O-])ccc2c1Cl |
| HS Code | 2934999090 |
|---|
|
~58%
3-Chloro-6-nitr... CAS#:34576-82-4 |
| Literature: Obushak; Matiichuk; Martyak Chemistry of Heterocyclic Compounds, 2003 , vol. 39, # 7 p. 878 - 884 |
|
~82%
3-Chloro-6-nitr... CAS#:34576-82-4 |
| Literature: Ried, Walter; Oremek, Gerhard; Ocakcioglu, Belkis Liebigs Annalen der Chemie, 1980 , # 9 p. 1424 - 1427 |
|
~31%
3-Chloro-6-nitr... CAS#:34576-82-4 |
| Literature: Obushak; Matiichuk; Martyak Chemistry of Heterocyclic Compounds, 2003 , vol. 39, # 7 p. 878 - 884 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-chloro-6-nitrobenzo[b]thiophene-2-carbonyl chloride |
| 3-Chlor-6-nitro-benzo-<b>-thiophen-2-carbonsaeurechlorid |
| 3-chloro-6-nitro-1-benzo[b]thiophene-2-carbonyl chloride |
| 6-Nitro-3-chlorobenzthien-2-carboxylic acid chloride |
| 2-Chlorcarbonyl-3-chlor-6-nitrobenzo<b>thiophen |